CymitQuimica logo

CAS 2623-40-7

:

1,3,6-Tribromo-2-naphthalenol

Description:
1,3,6-Tribromo-2-naphthalenol is an organic compound characterized by the presence of a naphthalene ring substituted with three bromine atoms and a hydroxyl group. Its molecular structure features a naphthalene backbone, which contributes to its aromatic properties, while the bromine substituents enhance its reactivity and influence its physical properties, such as solubility and melting point. The hydroxyl group (-OH) introduces polar characteristics, making the compound more soluble in polar solvents compared to non-polar ones. This compound is often studied for its potential applications in organic synthesis and as a reagent in various chemical reactions. Additionally, due to the presence of bromine, it may exhibit biological activity, making it of interest in medicinal chemistry. However, the environmental and health implications of brominated compounds necessitate careful handling and assessment of their toxicity. Overall, 1,3,6-Tribromo-2-naphthalenol is a notable compound in the field of organic chemistry, with unique properties stemming from its specific molecular structure.
Formula:C10H5Br3O
InChI:InChI=1S/C10H5Br3O/c11-6-1-2-7-5(3-6)4-8(12)10(14)9(7)13/h1-4,14H
InChI key:InChIKey=PVXCVWLUJUMQQU-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C=C(Br)C1O)C=C(Br)C=C2
Synonyms:
  • 1,3,6-Tribromo-[2]naphthol
  • 2-Naphthalenol, 1,3,6-tribromo-
  • 1,3,6-Tribromo-2-naphthalenol
  • 2-Naphthol, 1,3,6-tribromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.