CymitQuimica logo

CAS 262350-56-1

:

β-D-Glucopyranose 1,2,3,4-tetrakis(3,4,5-trihydroxybenzoate)

Description:
β-D-Glucopyranose 1,2,3,4-tetrakis(3,4,5-trihydroxybenzoate) is a complex glycoside derivative characterized by its glucopyranose backbone, which is a six-membered cyclic form of glucose. This compound features four esterified 3,4,5-trihydroxybenzoate groups attached to the hydroxyl positions of the glucopyranose ring. The presence of multiple hydroxyl groups contributes to its high solubility in polar solvents and potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. The trihydroxybenzoate moieties may impart antioxidant properties and enhance the compound's biological activity. This substance is of interest in various fields, including biochemistry and pharmacology, due to its potential applications in drug delivery systems and as a functional ingredient in food and cosmetic formulations. Its structural complexity and functional groups suggest that it may exhibit unique properties, such as enhanced stability or bioavailability, making it a subject of research in the development of novel therapeutic agents.
Formula:C34H28O22
InChI:InChI=1S/C34H28O22/c35-9-22-27(53-30(48)10-1-14(36)23(44)15(37)2-10)28(54-31(49)11-3-16(38)24(45)17(39)4-11)29(55-32(50)12-5-18(40)25(46)19(41)6-12)34(52-22)56-33(51)13-7-20(42)26(47)21(43)8-13/h1-8,22,27-29,34-47H,9H2/t22-,27-,28+,29-,34+/m1/s1
InChI key:InChIKey=XFLTYUCKJRFDOU-XPMKZLBQSA-N
SMILES:O(C(=O)C1=CC(O)=C(O)C(O)=C1)[C@@H]2[C@@H](OC(=O)C3=CC(O)=C(O)C(O)=C3)[C@H](OC(=O)C4=CC(O)=C(O)C(O)=C4)O[C@H](CO)[C@H]2OC(=O)C5=CC(O)=C(O)C(O)=C5
Synonyms:
  • β-D-Glucopyranose 1,2,3,4-tetrakis(3,4,5-trihydroxybenzoate)
  • β-D-Glucopyranose, 1,2,3,4-tetrakis(3,4,5-trihydroxybenzoate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.