
CAS 262352-32-9
:β-D-Glucopyranoside, 4-hydroxyphenyl, 6-[(2E)-3-(1-hydroxy-4-oxo-2,5-cyclohexadien-1-yl)-2-propenoate]
Description:
β-D-Glucopyranoside, 4-hydroxyphenyl, 6-[(2E)-3-(1-hydroxy-4-oxo-2,5-cyclohexadien-1-yl)-2-propenoate] is a complex organic compound characterized by its glycosidic structure, which includes a glucose moiety linked to a phenolic group. The presence of the 4-hydroxyphenyl group suggests potential antioxidant properties, while the cyclohexadienone moiety indicates reactivity typical of compounds with conjugated systems. This compound may exhibit solubility in polar solvents due to the hydroxyl groups, and its structural features suggest it could participate in various chemical reactions, including esterification and conjugation. The compound's unique structure may also confer biological activity, making it of interest in fields such as medicinal chemistry and natural product research. Its CAS number, 262352-32-9, allows for precise identification in chemical databases, facilitating further study and application in scientific research. Overall, this compound exemplifies the intersection of carbohydrate chemistry and phenolic compounds, highlighting the diverse functionalities that can arise from such structural combinations.
Formula:C21H22O10
InChI:InChI=1S/C21H22O10/c22-12-1-3-14(4-2-12)30-20-19(27)18(26)17(25)15(31-20)11-29-16(24)7-10-21(28)8-5-13(23)6-9-21/h1-10,15,17-20,22,25-28H,11H2/b10-7+/t15-,17-,18+,19-,20-/m1/s1
InChI key:InChIKey=KQIQKULTIAJZKL-VHFDLOJPSA-N
SMILES:O([C@@H]1O[C@H](COC(/C=C/C2(O)C=CC(=O)C=C2)=O)[C@@H](O)[C@H](O)[C@H]1O)C3=CC=C(O)C=C3
Synonyms:- β-D-Glucopyranoside, 4-hydroxyphenyl, 6-[(2E)-3-(1-hydroxy-4-oxo-2,5-cyclohexadien-1-yl)-2-propenoate]
- Robustaside D
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Robustaside D
CAS:<p>Robustaside D is a natural product that can be used as a reference standard. The CAS number of Robustaside D is 262352-32-9.</p>Formula:C21H22O10Color and Shape:SolidMolecular weight:434.397Robustaside D
CAS:<p>Robustaside D is a steroidal alkaloid, which is an organic compound derived from natural sources, specifically belonging to the Amaryllidaceae family. It exhibits a distinct mode of action by interacting with cellular targets, thereby inducing cytotoxic effects. The structural mechanisms involve interference with microtubule polymerization, which eventually leads to apoptosis in cancerous cells. This makes it a candidate for antitumor research, where its selective cytotoxicity can be harnessed for therapeutic strategies against specific cancer types.</p>Formula:C21H22O10Purity:Min. 95%Molecular weight:434.39 g/mol

