CAS 262381-84-0
:N-[[L-trans-3-(Ethoxycarbonyl)oxiran-2-yl]carbonyl]-L-leucyl-3-(p-hydroxyphenyl)ethylamide
Description:
N-[[L-trans-3-(Ethoxycarbonyl)oxiran-2-yl]carbonyl]-L-leucyl-3-(p-hydroxyphenyl)ethylamide is a synthetic organic compound characterized by its complex structure, which includes an epoxide group, an amide linkage, and a phenolic moiety. The presence of the ethoxycarbonyl group suggests that it may exhibit properties typical of esters, such as moderate polarity and potential for hydrogen bonding. The L-leucyl component indicates that it is a derivative of the amino acid leucine, which contributes to its biological activity and potential interactions with biological systems. The p-hydroxyphenyl group may enhance its solubility in organic solvents and influence its reactivity due to the presence of the hydroxyl group. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development or as a biochemical probe, owing to its unique structural features that could interact with specific biological targets. Further studies would be necessary to elucidate its specific properties, reactivity, and potential applications in various fields.
Formula:C20H28N2O6
InChI:InChI=1/C20H28N2O6/c1-4-12(3)15(22-19(25)16-17(28-16)20(26)27-5-2)18(24)21-11-10-13-6-8-14(23)9-7-13/h6-9,12,15-17,23H,4-5,10-11H2,1-3H3,(H,21,24)(H,22,25)/t12?,15-,16-,17-/m0/s1
SMILES:CCC(C)[C@@H](C(=NCCc1ccc(cc1)O)O)N=C([C@@H]1[C@@H](C(=O)OCC)O1)O
Synonyms:- ethyl (2S,3S)-3-{[(2S)-1-{[2-(4-hydroxyphenyl)ethyl]amino}-3-methyl-1-oxopentan-2-yl]carbamoyl}oxirane-2-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
JPM-OEt
CAS:<p>JMP-OEt is a synthetic analogue of the amino acid cysteine with potential anti-cancer properties. The compound has been shown to inhibit the growth of tumour cells, and to induce regression in primary tumours. It has been shown to have pharmacokinetic properties that are similar to those of cysteine, and can be metabolized into cysteine by cysteine proteinase. This means that it is not likely to accumulate in tissues because it will be degraded by proteases. JMP-OEt has also been shown to inhibit collagen production in vitro studies and may have therapeutic potential for treatment of diseases such as pancreatic cancer.</p>Formula:C20H28N2O6Purity:Min. 95%Molecular weight:392.4 g/molJPM-OEt
CAS:JPM-OEt: broad-spectrum, covalent cysteine cathepsin inhibitor with antitumor effects.Formula:C20H28N2O6Purity:98%Color and Shape:SolidMolecular weight:392.45

