CAS 262423-83-6
:1,2-Propanediol, 1-methanesulfonate, (2S)-
Description:
1,2-Propanediol, 1-methanesulfonate, (2S)-, also known by its CAS number 262423-83-6, is an organic compound characterized by the presence of a propanediol backbone with a methanesulfonate group attached. This compound typically exhibits properties associated with both alcohols and sulfonates, including solubility in water due to the hydrophilic nature of the sulfonate group. The (2S)- designation indicates that it has a specific stereochemistry, which can influence its reactivity and interactions in biological systems. It may be used in various applications, including as a reagent in organic synthesis or in the development of pharmaceuticals. The presence of the methanesulfonate group can enhance the compound's ability to participate in nucleophilic substitution reactions, making it a valuable intermediate in chemical synthesis. Additionally, its low volatility and relatively high boiling point suggest stability under standard laboratory conditions. As with any chemical substance, safety precautions should be observed when handling it, including the use of appropriate personal protective equipment.
Formula:C4H10O4S
InChI:InChI=1S/C4H10O4S/c1-4(5)3-8-9(2,6)7/h4-5H,3H2,1-2H3/t4-/m0/s1
InChI key:InChIKey=CKQAPCVWBGOGEW-BYPYZUCNSA-N
SMILES:O(S(C)(=O)=O)C[C@H](C)O
Synonyms:- 1,2-Propanediol 1-methanesulfonate (2S)-
- 1,2-Propanediol, 1-methanesulfonate, (2S)-
- (2S)-2-Hydroxypropyl methanesulfonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2S)-2-Hydroxy-1-propyl Methanesulfonate
CAS:Formula:C4H10O4SColor and Shape:LiquidMolecular weight:154.1848(2S)-2-Hydroxy-1-propyl Methanesulfonate
CAS:Controlled Product<p>Applications Used in the preparation of labeled cocaine analogs.<br>References Carroll, F.I., et al.: J. Med. Chem., 35, 2497 (1992),<br></p>Formula:C4H10O4SColor and Shape:NeatMolecular weight:154.18(2S)-2-Hydroxy-1-propyl methanesulfonate
CAS:(2S)-2-Hydroxy-1-propyl methanesulfonate is an analog inhibitor of kinases, which are enzymes that play a crucial role in cell signaling and regulation. This compound has been shown to induce apoptosis in human cancer cells, making it a potential anticancer agent. It has been found to be effective against various types of tumors, including those found in the Chinese hamster ovary and urine bladder. This medicinal compound works by inhibiting specific proteins involved in tumor growth and progression. Its kinase inhibition properties make it a promising candidate for the development of novel cancer therapies.Formula:C4H10O4SPurity:Min. 95%Molecular weight:154.19 g/mol


