CymitQuimica logo

CAS 262444-42-8

:

tert-butyl [2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate

Description:
Tert-butyl [2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate is a chemical compound characterized by its complex structure, which includes a tert-butyl group, a fluorinated phenyl moiety, and a dioxaborolane unit. This compound is typically used in organic synthesis and medicinal chemistry, particularly as a building block in the development of pharmaceuticals. The presence of the fluorine atom enhances its lipophilicity and can influence biological activity, while the dioxaborolane group is known for its ability to participate in various chemical reactions, including Suzuki coupling. The tert-butyl carbamate functionality serves as a protective group for amines, making it useful in synthetic pathways. The compound's stability, solubility, and reactivity can be influenced by the steric and electronic effects of its substituents. Overall, this compound exemplifies the intricate design often required in the synthesis of biologically active molecules, showcasing the interplay between structure and function in chemical applications.
Formula:C17H25BFNO4
InChI:InChI=1/C17H25BFNO4/c1-15(2,3)22-14(21)20-13-9-8-11(10-12(13)19)18-23-16(4,5)17(6,7)24-18/h8-10H,1-7H3,(H,20,21)
InChI key:KETIHPKFQXFMTA-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=Nc1ccc(cc1F)B1OC(C)(C)C(C)(C)O1)O
Found 4 products.