CAS 262587-05-3

1-Bromo-3-(difluoromethoxy)benzene

Description:

1-Bromo-3-(difluoromethoxy)benzene is an organic compound characterized by the presence of a bromine atom and a difluoromethoxy group attached to a benzene ring. This compound features a bromine substituent at the first position and a difluoromethoxy group at the third position of the aromatic ring, which contributes to its unique chemical properties. The difluoromethoxy group enhances the compound's reactivity and polarity, making it useful in various chemical reactions, particularly in the synthesis of more complex organic molecules. The presence of fluorine atoms typically increases the compound's stability and lipophilicity, which can influence its behavior in biological systems. Additionally, the bromine atom can serve as a leaving group in nucleophilic substitution reactions, further expanding its utility in organic synthesis. Overall, 1-Bromo-3-(difluoromethoxy)benzene is a valuable compound in medicinal chemistry and materials science, where its distinct functional groups can be exploited for the development of new pharmaceuticals and advanced materials.

Formula: C₇H₅BrF₂O

InChI: InChI=1/C7H5BrF2O/c8-5-2-1-3-6(4-5)11-7(9)10/h1-4,7H

SMILES: c1cc(cc(c1)OC(F)F)Br

Synonyms:

• 3-Bromophenyl difluoromethyl ether
• Benzene, 1-bromo-3-(difluoromethoxy)-
• Fyfor Ce
• 3-(Difluoromethoxy)Bromobenzene
• 1-Bromo-3-Difluoromethoxybenzene

Benzene, 1-bromo-3-(difluoromethoxy)-

CAS: 262587-05-3

Formula: C₇H₅BrF₂O

Purity: 98%

Color and Shape: Liquid

Molecular weight: 223.0148

Ref: IN-DA002SHB

3-(Difluoromethoxy)bromobenzene

CAS: 262587-05-3

3-(Difluoromethoxy)bromobenzene

Formula: C₇H₅BrF₂O

Purity: 98%

Color and Shape: Colourless Liquid

Molecular weight: 223.01g/mol

Ref: 54-PC3429

3-(Difluoromethoxy)bromobenzene

CAS: 262587-05-3

Formula: C₇H₅BrF₂O

Purity: 98%

Color and Shape: Liquid

Molecular weight: 223.017

Ref: 10-F007863