CAS 26272-83-3
:oxetan-3-yl 4-methylbenzenesulfonate
Description:
Oxetan-3-yl 4-methylbenzenesulfonate, with the CAS number 26272-83-3, is an organic compound characterized by its unique structure that includes an oxetane ring and a sulfonate group. The oxetane ring, a four-membered cyclic ether, contributes to the compound's reactivity and potential applications in organic synthesis. The presence of the 4-methylbenzenesulfonate moiety enhances its solubility in polar solvents and provides a site for nucleophilic substitution reactions. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a leaving group in various chemical reactions. Additionally, the sulfonate group can impart desirable properties such as increased stability and improved handling characteristics. As with many sulfonate esters, it may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures in laboratory settings. Overall, oxetan-3-yl 4-methylbenzenesulfonate is a valuable intermediate in chemical synthesis, showcasing the interplay between structural features and reactivity.
Formula:C10H12O4S
InChI:InChI=1/C10H12O4S/c1-8-2-4-10(5-3-8)15(11,12)14-9-6-13-7-9/h2-5,9H,6-7H2,1H3
SMILES:Cc1ccc(cc1)S(=O)(=O)OC1COC1
Synonyms:- 3-Oxetanol, 4-methylbenzenesulfonateoxetan-3-yl 4-methylbenzene-1-sulfonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Oxetan-3-yl 4-methylbenzenesulfonate
CAS:Oxetan-3-yl 4-methylbenzenesulfonateFormula:C10H12O4SPurity:97%Color and Shape: white solidMolecular weight:228.26g/mol3-Oxetanyl p-Toluenesulfonate
CAS:Formula:C10H12O4SPurity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:228.26Oxetan-3-yl 4-methylbenzenesulfonate
CAS:Formula:C10H12O4SPurity:98%Color and Shape:SolidMolecular weight:228.263-Oxetanyl p-toluenesulfonate, 96%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C10H12O4SPurity:96%Molecular weight:228.27





