CymitQuimica logo

CAS 26274-35-1

:

2,4-Diphenylpyridine

Description:
2,4-Diphenylpyridine is an organic compound characterized by its pyridine ring substituted at the 2 and 4 positions with phenyl groups. This structure contributes to its unique chemical properties, including its potential as a ligand in coordination chemistry and its role in organic synthesis. The compound typically exhibits a solid state at room temperature and is known for its relatively high melting point. It is generally insoluble in water but soluble in organic solvents, which is common for many aromatic compounds. 2,4-Diphenylpyridine may display interesting electronic properties due to the presence of the electron-rich phenyl groups, making it a candidate for applications in materials science and organic electronics. Additionally, its chemical stability and ability to participate in various reactions, such as electrophilic substitutions, enhance its utility in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C17H13N
InChI:InChI=1S/C17H13N/c1-3-7-14(8-4-1)16-11-12-18-17(13-16)15-9-5-2-6-10-15/h1-13H
InChI key:InChIKey=YASXBDJBCBUIHT-UHFFFAOYSA-N
SMILES:C=1(C=C(N=CC1)C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:
  • Pyridine, 2,4-Diphenyl-
  • 2,4-Diphenylpyridine
Found 6 products.