CAS 26278-78-4

2-Amino-6-benzothiazolol hydrochloride

Description:

2-Amino-6-benzothiazolol hydrochloride, with the CAS number 26278-78-4, is a chemical compound characterized by its unique structure that includes a benzothiazole moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water, which is a common trait for many hydrochloride salts. The presence of an amino group contributes to its basicity, while the benzothiazole ring system imparts specific biological and chemical properties. It is often utilized in various applications, including pharmaceuticals, where it may serve as an intermediate in the synthesis of other compounds or as a potential active ingredient due to its biological activity. The hydrochloride form enhances its stability and solubility, making it easier to handle in laboratory and industrial settings. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken.

Formula: C₇H₇ClN₂OS

InChI: InChI=1/C7H6N2OS.ClH/c8-7-9-5-2-1-4(10)3-6(5)11-7;/h1-3,10H,(H2,8,9);1H

SMILES: c1cc2c(cc1O)sc(=N)[nH]2.Cl

Synonyms:

• 2-Amino-1,3-benzothiazol-6-ol hydrochloride (1:1)
• 6-Benzothiazolol, 2-Amino-, Hydrochloride (1:1)
• 2-Amino-1,3-Benzothiazol-6-Ol Hydrochloride

2-Amino-6-benzothiazolol, HCl

CAS: 26278-78-4

Formula: C₇H₇ClN₂OS

Molecular weight: 202.6613

Ref: IN-DA002SKN

2-Aminobenzo[d]thiazol-6-ol hydrochloride

CAS: 26278-78-4

Formula: C₇H₇ClN₂OS

Purity: 95.0%

Molecular weight: 202.66

Ref: 10-F321739