
CAS 26281-69-6
:2-[3-(Hexyloxy)-2-hydroxypropoxy]benzoic acid
Description:
2-[3-(Hexyloxy)-2-hydroxypropoxy]benzoic acid, with the CAS number 26281-69-6, is an organic compound characterized by its complex structure that includes a benzoic acid moiety and a hexyloxy group. This compound features a hydroxyl group and an ether linkage, which contribute to its solubility and reactivity. It is typically a white to off-white solid at room temperature and may exhibit moderate to high solubility in organic solvents due to the presence of the hexyloxy chain. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may act as a weak acid. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical and chemical research. Its molecular structure allows for potential applications in various fields, including materials science and drug formulation. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health or environmental risks.
Formula:C16H24O5
InChI:InChI=1S/C16H24O5/c1-2-3-4-7-10-20-11-13(17)12-21-15-9-6-5-8-14(15)16(18)19/h5-6,8-9,13,17H,2-4,7,10-12H2,1H3,(H,18,19)
InChI key:InChIKey=YTPJKQPMTSNTGI-UHFFFAOYSA-N
SMILES:O(CC(COCCCCCC)O)C1=C(C(O)=O)C=CC=C1
Synonyms:- 2-[3-(Hexyloxy)-2-hydroxypropoxy]benzoic acid
- o-(2-Hydroxy-3-hexyloxypropoxy)benzoic acid
- Exiproben
- Benzoic acid, o-[3-(hexyloxy)-2-hydroxypropoxy]-
- Benzoic acid, 2-[3-(hexyloxy)-2-hydroxypropoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Exiproben
CAS:<p>Exiproben is a biochemical.</p>Formula:C16H24O5Color and Shape:SolidMolecular weight:296.36
