CAS 262853-30-5

3,4-dihydroquinoline-1(2H)-carbothioamide

Description:

3,4-Dihydroquinoline-1(2H)-carbothioamide is a chemical compound characterized by its unique structure, which includes a quinoline ring system and a carbothioamide functional group. This compound typically exhibits properties associated with both heterocyclic compounds and thioamides, such as potential biological activity and reactivity. The presence of the dihydroquinoline moiety suggests that it may participate in various chemical reactions, including nucleophilic substitutions and cyclizations. Additionally, the carbothioamide group can influence the compound's solubility and stability, as well as its interaction with biological targets. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial or anticancer activities. Its CAS number, 262853-30-5, allows for easy identification and retrieval of information in chemical databases. Overall, 3,4-dihydroquinoline-1(2H)-carbothioamide represents a versatile structure that could be explored for various applications in research and development.

Formula: C₁₀H₁₂N₂S

InChI: InChI=1/C10H12N2S/c11-10(13)12-7-3-5-8-4-1-2-6-9(8)12/h1-2,4,6H,3,5,7H2,(H2,11,13)

SMILES: c1ccc2c(c1)CCCN2C(=N)S

Synonyms:

• 1(2H)-Quinolinecarbothioamide, 3,4-dihydro-
• 3,4-Dihydroquinoline-1(2H)-carbothioamide

Amino-1,2,3,4-tetrahydroquinol-1-ylmethane-1-thione

CAS: 262853-30-5

Please enquire for more information about Amino-1,2,3,4-tetrahydroquinol-1-ylmethane-1-thione including the price, delivery time and more detailed product information at the technical inquiry form on this page

Purity: Min. 95%

Ref: 3D-FA169182