CAS 26293-93-6

2,6-dichloropyrimidine-4-carbonitrile

Description:

2,6-Dichloropyrimidine-4-carbonitrile is a heterocyclic organic compound characterized by its pyrimidine ring, which contains two chlorine substituents at the 2 and 6 positions and a cyano group (-C≡N) at the 4 position. This compound is typically a crystalline solid and is known for its role in various chemical syntheses, particularly in the pharmaceutical industry, where it can serve as an intermediate in the production of biologically active compounds. The presence of chlorine atoms enhances its reactivity and can influence its solubility and stability in different solvents. The cyano group contributes to its polar nature, making it useful in reactions such as nucleophilic substitutions. Additionally, 2,6-dichloropyrimidine-4-carbonitrile may exhibit biological activity, which can be explored in medicinal chemistry. Safety data sheets should be consulted for handling precautions, as halogenated compounds can pose environmental and health risks. Overall, this compound is significant in synthetic organic chemistry and has potential applications in drug development.

Formula: C₅HCl₂N₃

InChI: InChI=1/C5HCl2N3/c6-4-1-3(2-8)9-5(7)10-4/h1H

SMILES: c1c(C#N)nc(Cl)nc1Cl

Synonyms:

• 4-Pyrimidinecarbonitrile, 2,6-dichloro-
• 2,6-Dichloropyrimidine-4-carbonitrile

4-Pyrimidinecarbonitrile, 2,6-dichloro-

CAS: 26293-93-6

Formula: C₅HCl₂N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 173.9875

Ref: IN-DA002SLS

2,6-Dichloropyrimidine-4-carbonitrile

CAS: 26293-93-6

2,6-Dichloropyrimidine-4-carbonitrile

Purity: 98%

Color and Shape: Solid

Molecular weight: 173.99g/mol

Ref: 54-OR919202

2,6-Dichloropyrimidine-4-carbonitrile

CAS: 26293-93-6

Formula: C₅HCl₂N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 173.98

Ref: 10-F079702