CAS 26294-19-9
:N-(2-hydroxyethyl)-N-methylglycine
Description:
N-(2-hydroxyethyl)-N-methylglycine, commonly known as betaine, is an amino acid derivative characterized by its zwitterionic nature, which means it possesses both positive and negative charges within the same molecule, leading to unique solubility properties. This compound features a hydroxyl group and a methyl group attached to the nitrogen atom, contributing to its stability and reactivity. It is typically soluble in water, making it useful in various biological and industrial applications. Betaine is known for its role as an osmoprotectant, helping cells maintain their structure and function under stress conditions, such as high salinity or dehydration. Additionally, it serves as a methyl donor in biochemical pathways, particularly in the synthesis of methionine from homocysteine. Its low toxicity and biocompatibility make it a favorable choice in cosmetics, pharmaceuticals, and as a feed additive in animal nutrition. Overall, N-(2-hydroxyethyl)-N-methylglycine is a versatile compound with significant implications in both biological systems and industrial applications.
Formula:C5H11NO3
InChI:InChI=1/C5H11NO3/c1-6(2-3-7)4-5(8)9/h7H,2-4H2,1H3,(H,8,9)
SMILES:CN(CCO)CC(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N-(2-Hydroxyethyl)-N-methylglycine
CAS:<p>N-(2-Hydroxyethyl)-N-methylglycine is a surfactant with amphoteric properties. It is an amide that consists of a fatty acid and an amine group. The amphoteric surfactants are used as an additive to keep oil and water from separating in products such as shampoos, soaps, and detergents. They also act as absorbers for impurities in the air or on surfaces, which can be removed by washing with soap or detergent. N-(2-Hydroxyethyl)-N-methylglycine is also used as a cationic surfactant in cosmetic products. It has been shown to have some antibacterial activity against bacteria such as Staphylococcus aureus and Clostridium perfringens.</p>Formula:C5H11NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:133.15 g/mol
