CAS 26298-61-3
:Hexamethyldisiloxane homopolymer
Description:
Hexamethyldisiloxane homopolymer, identified by its CAS number 26298-61-3, is a silicone-based polymer characterized by its unique siloxane (Si-O) backbone. This polymer is known for its excellent thermal stability, chemical resistance, and low surface tension, making it suitable for various applications, including sealants, adhesives, and coatings. Its structure consists of repeating units of hexamethyldisiloxane, which contributes to its flexibility and low viscosity. Additionally, it exhibits hydrophobic properties, which enhance its performance in moisture-sensitive environments. The polymer is also recognized for its low volatility and minimal odor, making it user-friendly in consumer products. Due to its biocompatibility, it finds applications in the medical field as well. Overall, hexamethyldisiloxane homopolymer is valued for its versatility and effectiveness in enhancing the performance of formulations across multiple industries.
Formula:(C6H18OSi2)x
InChI:InChI=1S/C6H18OSi2/c1-8(2,3)7-9(4,5)6/h1-6H3
InChI key:InChIKey=UQEAIHBTYFGYIE-UHFFFAOYSA-N
SMILES:O([Si](C)(C)C)[Si](C)(C)C
Synonyms:- Disiloxane, hexamethyl-, polymers
- Disiloxane, 1,1,1,3,3,3-hexamethyl-, homopolymer
- Hexamethyldisiloxane polymer
- Disiloxane, hexamethyl-, homopolymer
- Poly(hexamethyldisiloxane)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
