CAS 263012-63-1

2-chloro-5-ethynylpyridine

Description:

2-Chloro-5-ethynylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the second position and an ethynyl group at the fifth position of the pyridine ring contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its reactivity, particularly in nucleophilic substitution reactions due to the electron-withdrawing nature of the chloro substituent. The ethynyl group introduces a triple bond, which can participate in various coupling reactions, making it useful in organic synthesis and material science. Additionally, 2-chloro-5-ethynylpyridine may exhibit biological activity, making it of interest in pharmaceutical research. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.

Formula: C₇H₄ClN

InChI: InChI=1/C7H4ClN/c1-2-6-3-4-7(8)9-5-6/h1,3-5H

SMILES: C#Cc1ccc(Cl)nc1

Synonyms:

• Pyridine, 2-chloro-5-ethynyl-

Pyridine, 2-chloro-5-ethynyl-

CAS: 263012-63-1

Formula: C₇H₄ClN

Purity: 96%

Color and Shape: Solid

Molecular weight: 137.5664

Ref: IN-DA002SMJ

2-Chloro-5-ethynylpyridine

CAS: 263012-63-1

2-Chloro-5-ethynylpyridine

Purity: 95%

Molecular weight: 137.57g/mol

Ref: 54-OR76148

2-Chloro-5-ethynylpyridine

CAS: 263012-63-1

Formula: C₇H₄ClN

Purity: 95%

Color and Shape: Solid

Molecular weight: 137.57

Ref: 10-F046449

2-Chloro-5-ethynylpyridine

Controlled Product

CAS: 263012-63-1

Formula: C₇H₄ClN

Color and Shape: Neat

Molecular weight: 137.566

Ref: TR-C366210

2-Chloro-5-ethynylpyridine

CAS: 263012-63-1

Versatile small molecule scaffold

Formula: C₇H₄ClN

Purity: Min. 95%

Molecular weight: 137.57 g/mol

Ref: 3D-NKA01263