
CAS 26305-08-8
:N-Methyl-N-nitro-N′-nitrosoguanidine
Description:
N-Methyl-N-nitro-N′-nitrosoguanidine (MNNG) is a potent alkylating agent known for its role in molecular biology and cancer research. It is a nitrosourea compound that can introduce alkyl groups into DNA, leading to mutations and potentially initiating carcinogenesis. MNNG is characterized by its ability to form DNA adducts, which can disrupt normal cellular processes and contribute to genetic instability. The compound is typically a pale yellow solid and is soluble in organic solvents. Due to its mutagenic properties, MNNG is often used in laboratory settings to induce mutations in various organisms, including bacteria and mammalian cells, making it a valuable tool for studying gene function and the mechanisms of carcinogenesis. However, it is also classified as a hazardous substance, requiring careful handling and disposal to mitigate risks associated with exposure. Its use is regulated in many jurisdictions due to its potential health risks, including carcinogenicity.
Formula:C2H5N5O3
InChI:InChI=1S/C2H5N5O3/c1-6(7(9)10)2(3)4-5-8/h1H3,(H2,3,4,8)
InChI key:InChIKey=UKIDUMMXBQMTKO-UHFFFAOYSA-N
SMILES:N(C(NN=O)=N)(N(=O)=O)C
Synonyms:- Guanidine, 1-methyl-1-nitro-2-nitroso-
- N-Methyl-N-nitro-N′-nitrosoguanidine
- Guanidine, N-methyl-N-nitro-N′-nitroso-
- N-Methyl-N′-nitroso-N-nitroguanidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

