CAS 2631-30-3
:4-ethylphenyl methylcarbamate
Description:
4-Ethylphenyl methylcarbamate, with the CAS number 2631-30-3, is an organic compound belonging to the class of carbamates. It features a methylcarbamate functional group attached to a 4-ethylphenyl moiety, which contributes to its chemical properties. This compound is typically characterized by its moderate solubility in organic solvents and relatively low solubility in water, reflecting its hydrophobic nature due to the ethylphenyl group. It is often used in various applications, including as an intermediate in organic synthesis and potentially in agricultural formulations. The presence of the carbamate group suggests that it may exhibit biological activity, which can include herbicidal or insecticidal properties. Safety and handling precautions are essential, as carbamates can be toxic and may pose environmental risks. As with many chemical substances, understanding its reactivity, stability, and potential interactions with other compounds is crucial for its safe use in industrial or laboratory settings.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2/c1-3-8-4-6-9(7-5-8)13-10(12)11-2/h4-7H,3H2,1-2H3,(H,11,12)
Synonyms:- Phenol, 4-ethyl-, methylcarbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

