CAS 263149-10-6

4-chloro-7-hydroxy-6-methoxyquinoline-3-carbonitrile

Description:

4-Chloro-7-hydroxy-6-methoxyquinoline-3-carbonitrile is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features several functional groups, including a chloro group, a hydroxy group, a methoxy group, and a carbonitrile group, contributing to its unique chemical properties. The presence of the chloro substituent enhances its reactivity, while the hydroxy and methoxy groups can participate in hydrogen bonding and influence solubility. The carbonitrile group introduces a polar functional group that can engage in various chemical reactions, such as nucleophilic additions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, 4-chloro-7-hydroxy-6-methoxyquinoline-3-carbonitrile represents a complex structure with potential applications in various fields of chemistry and pharmacology.

Formula: C₁₁H₇ClN₂O₂

InChI: InChI=1/C11H7ClN2O2/c1-16-10-2-7-8(3-9(10)15)14-5-6(4-13)11(7)12/h2-3,5,15H,1H3

SMILES: COc1cc2c(cc1O)ncc(C#N)c2Cl

Synonyms:

• 4-Chlor-7-hydroxy-6-methoxychinolin-3-carbonitril
• 4-Chloro-3-Cyano-7-Hydroxy-6-Methoxyquinoline
• 4-Chloro-7-Hydroxy-6-Methoxy-Quinoline-3-Carbonitrile

3-Quinolinecarbonitrile, 4-chloro-7-hydroxy-6-methoxy-

CAS: 263149-10-6

Formula: C₁₁H₇ClN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 234.6385

Ref: IN-DA002SOH

Bosutinib Impurity 35

CAS: 263149-10-6

Formula: C₁₁H₇ClN₂O₂

Molecular weight: 234.64

Ref: 4Z-B-6439

4-Chloro-7-hydroxy-6-methoxyquinoline-3-carbonitrile

CAS: 263149-10-6

4-Chloro-7-hydroxy-6-methoxyquinoline-3-carbonitrile

Purity: 98%

Molecular weight: 234.64g/mol

Ref: 54-OR96063

4-Chloro-7-hydroxy-6-methoxyquinoline-3-carbonitrile

CAS: 263149-10-6

Formula: C₁₁H₇ClN₂O₂

Purity: 98%

Color and Shape: Liquid, No data available.

Molecular weight: 234.64

Ref: 10-F222664

4-Chloro-7-hydroxy-6-methoxy-3-quinolinecarbonitrile

Controlled Product

CAS: 263149-10-6

Applications 4-Chloro-7-hydroxy-6-methoxy-3-quinolinecarbonitrile is a synthetic compound used in the synthesis of Src inhibitors.
References Boschelli, D., et al.: J. Med. Chem., 44, 3965 (2001); Cao, X., et al.: Bioorg. Med. Chem. Lett., 17, 5978 (2007);

Formula: C₁₁H₇ClN₂O₂

Color and Shape: Neat

Molecular weight: 234.64

Ref: TR-C368585

Bosutinib Impurity 35

CAS: 263149-10-6

Formula: C₁₁H₇ClN₂O₂

Molecular weight: 234.64

Ref: ST-EA-CP-B80031