CAS 263169-14-8
:N-Methyl-N-(2-methylpropyl)sulfamoyl chloride
Description:
N-Methyl-N-(2-methylpropyl)sulfamoyl chloride is a chemical compound characterized by its sulfonamide functional group, which includes a sulfur atom bonded to an oxygen atom and a nitrogen atom. This compound features a methyl group and a branched alkyl chain (2-methylpropyl) attached to the nitrogen, contributing to its unique properties. As a sulfonamide derivative, it is likely to exhibit properties typical of sulfonamides, such as potential antimicrobial activity, although specific biological activities would depend on its structure and substituents. The presence of the chloride group indicates that it can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the compound is expected to be soluble in polar organic solvents due to the presence of the sulfonamide and chloride functionalities. Safety precautions should be taken when handling this compound, as it may be irritant or toxic. Overall, N-Methyl-N-(2-methylpropyl)sulfamoyl chloride is a versatile compound with potential applications in pharmaceuticals and organic chemistry.
Formula:C5H12ClNO2S
InChI:InChI=1S/C5H12ClNO2S/c1-5(2)4-7(3)10(6,8)9/h5H,4H2,1-3H3
InChI key:InChIKey=BSJMWAIBHXXHJE-UHFFFAOYSA-N
SMILES:N(CC(C)C)(S(Cl)(=O)=O)C
Synonyms:- Isobutyl(methyl)sulfamyl chloride
- N-Methyl-N-(2-methylpropyl)sulfamoyl chloride
- Sulfamoyl Chloride, Methyl(2-Methylpropyl)-
- Sulfamoyl chloride, N-methyl-N-(2-methylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
