CAS 26317-70-4
:Ruthenium, (acetato-κO)dicarbonyl-, homopolymer
Description:
Ruthenium, (acetato-κO)dicarbonyl-, homopolymer, identified by the CAS number 26317-70-4, is a coordination compound featuring ruthenium as the central metal atom. This substance is characterized by its coordination with acetate ligands and carbonyl groups, which contribute to its unique chemical properties. The presence of dicarbonyl groups indicates that two carbon monoxide molecules are coordinated to the ruthenium center, enhancing its stability and reactivity. The homopolymeric nature suggests that the compound forms extended structures through repeated units, which can influence its physical properties, such as solubility and thermal stability. Ruthenium complexes are often studied for their catalytic properties, particularly in organic synthesis and materials science. Additionally, the acetate ligands can impart solubility in polar solvents, making this compound potentially useful in various applications, including catalysis and as precursors in the synthesis of other ruthenium-based materials. Overall, this compound exemplifies the diverse chemistry of transition metal complexes and their potential utility in advanced chemical applications.
Formula:(C4H3O4Ru)x
InChI:InChI=1S/C2H4O2.2CO.Ru/c1-2(3)4;2*1-2;/h1H3,(H,3,4);;;/q;;;+1/p-1
InChI key:InChIKey=GNUMCPJBCMWHOH-UHFFFAOYSA-M
SMILES:[Ru+]([O-]C(C)=O)(C#O)C#O
Synonyms:- Acetatodicarbonylrutheniumpolymerorangepowder
- Ruthenium, (acetato)dicarbonyl-, polymers
- Ruthenium, (acetato-O)dicarbonyl-, homopolymer
- Ruthenium, (acetato-κO)dicarbonyl-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acetatodicarbonylruthenium, polymer
CAS:Acetatodicarbonylruthenium, polymer
Formula:Ru(CO)2CH3COOColor and Shape:orange pwdr.Molecular weight:(216.14)é

