CAS 26328-35-8
:2,4,5-trichlorophenyl isocyanate
Description:
2,4,5-Trichlorophenyl isocyanate is an organic compound characterized by its isocyanate functional group attached to a trichlorophenyl moiety. It is typically a colorless to pale yellow liquid with a pungent odor, indicative of its reactivity. This compound is known for its high reactivity, particularly with nucleophiles, which makes it useful in organic synthesis, especially in the production of various pharmaceuticals and agrochemicals. Its structure includes three chlorine atoms substituted on the phenyl ring, which significantly influences its chemical properties, including increased electrophilicity. 2,4,5-Trichlorophenyl isocyanate is also recognized for its potential toxicity and environmental hazards, necessitating careful handling and storage. It can cause irritation to the skin, eyes, and respiratory system, and appropriate safety measures should be employed when working with this compound. Additionally, it is important to consider its stability under various conditions, as isocyanates can decompose or react with moisture, leading to the formation of urea derivatives.
Formula:C7H2Cl3NO
InChI:InChI=1/C7H2Cl3NO/c8-4-1-6(10)7(11-3-12)2-5(4)9/h1-2H
SMILES:c1c(c(cc(c1Cl)N=C=O)Cl)Cl
Synonyms:- 1,2,4-Trichloro-5-Isocyanatobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
