CAS 26328-53-0
:Amoscanate
Description:
Amoscanate, with the CAS number 26328-53-0, is a chemical compound that belongs to the class of aromatic amines. It is primarily recognized for its application in the field of pharmaceuticals and as a potential intermediate in organic synthesis. The compound typically exhibits characteristics such as a moderate molecular weight and specific functional groups that contribute to its reactivity and solubility in various solvents. Amoscanate may also display biological activity, which has led to its investigation in medicinal chemistry. Its structure includes an amine group, which is significant for its interactions in biological systems. Safety data sheets indicate that, like many aromatic amines, it should be handled with care due to potential health risks, including toxicity and carcinogenicity. Proper storage and handling protocols are essential to mitigate any hazards associated with exposure. Overall, Amoscanate is a compound of interest in both industrial and research settings, warranting further exploration of its properties and applications.
Formula:C13H9N3O2S
InChI:InChI=1/C13H9N3O2S/c17-16(18)13-7-5-12(6-8-13)15-11-3-1-10(2-4-11)14-9-19/h1-8,15H
InChI key:InChIKey=DKVNAGXPRSYHLB-UHFFFAOYSA-N
SMILES:N(C1=CC=C(N(=O)=O)C=C1)C2=CC=C(N=C=S)C=C2
Synonyms:- 4-Isothiocyanato-N-(4-nitrophenyl)benzenamine
- Nithiocyanamine
- 4-isothiocyanato-N-(4-nitrophenyl)aniline
- Diphenylamine, 4-isothiocyanato-4′-nitro-
- 4-Nitro-4′-isothiocyanatodiphenylamine
- Benzenamine, 4-isothiocyanato-N-(4-nitrophenyl)-
- Isothiocyanic acid, p-(p-nitroanilino)phenyl ester
- amoscanate USP/EP/BP
- 4-Nitro-4'-iso-thiocyanate diphenyl amine
- GO 9333
- C-9333 GO
- CCRIS 4111
- CIBA-9333 GO
- Nithiocyamine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Isothiocyanato-N-(4-nitrophenyl)-aniline
CAS:4-Isothiocyanato-N-(4-nitrophenyl)-anilinePurity:98%Molecular weight:271.3g/molAmoscanate
CAS:Amoscanate is an antiparasitic agent. It is highly effective in animals against the four major species of schistosomes which infect humans.Formula:C13H9N3O2SColor and Shape:SolidMolecular weight:271.29Amoscanate
CAS:Amoscanate is an antischistosomal agent, which is a synthetic compound with a broad spectrum of activity against parasitic infections. Its mode of action involves the disruption of parasite metabolism and structure, ultimately leading to the elimination of schistosomes. Schistosomes are trematode worms responsible for schistosomiasis, a significant parasitic disease affecting millions of people worldwide.Formula:C13H9N3O2SPurity:Min. 95%Molecular weight:271.3 g/mol


