CAS 26334-20-3
:2,6-dimethylphenyl azide
Description:
2,6-Dimethylphenyl azide is an organic compound characterized by the presence of an azide functional group (-N3) attached to a 2,6-dimethylphenyl moiety. This compound typically appears as a yellow to orange solid and is known for its sensitivity to heat and shock, making it potentially hazardous. The azide group is known for its ability to undergo thermal decomposition, leading to the release of nitrogen gas, which can be explosive under certain conditions. In terms of solubility, 2,6-dimethylphenyl azide is generally soluble in organic solvents such as acetone and ether but has limited solubility in water. The compound is often utilized in organic synthesis, particularly in the field of click chemistry, where it can participate in various reactions, including cycloadditions. Due to its reactive nature, appropriate safety precautions should be taken when handling this substance, including the use of personal protective equipment and working in a controlled environment.
Formula:C8H9N3
InChI:InChI=1/C8H9N3/c1-6-4-3-5-7(2)8(6)10-11-9/h3-5H,1-2H3
SMILES:Cc1cccc(C)c1N=[N+]=[NH-]
Synonyms:- 2,6-Dimethylphenylazide
- Benzene, 2-azido-1,3-dimethyl-
- m-Xylene, 2-azido-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Azido-1,3-dimethylbenzene
CAS:2-Azido-1,3-dimethylbenzene is a compound with the molecular formula of C6H5N3O. It is a colorless liquid that has a melting point of -8°C, boiling point of 165°C, and density of 1.1 g/mL. The compound belongs to the group of phenyl compounds and has a depolarization value of 0.037 cm1M in an ortho position. This compound has shown to have vibrational and vibrational spectra that are very similar to those found in the deuterated molecule (C6D6)2N3O.
Formula:C8H9N3Purity:Min. 95%Molecular weight:147.18 g/mol
