CAS 26334-85-0: meso-Tetraphenylporphyrin-Sn(IV) dichlorid
Description:Meso-Tetraphenylporphyrin-Sn(IV) dichloride is a coordination compound featuring a tin(IV) ion coordinated to a meso-tetraphenylporphyrin ligand. This compound exhibits a characteristic porphyrin structure, which consists of a large, planar, cyclic arrangement of carbon and nitrogen atoms, allowing for extensive π-conjugation. The presence of the tin(IV) ion introduces unique electronic properties, making it a subject of interest in various fields, including catalysis and materials science. The dichloride form indicates that two chloride ions are coordinated to the tin center, influencing the compound's solubility and reactivity. Meso-tetraphenylporphyrin derivatives are known for their vibrant colors, typically exhibiting strong absorption in the visible region due to their electronic transitions. This compound can also participate in redox reactions, making it useful in studies related to electron transfer processes. Additionally, its stability and ability to form complexes with other metal ions enhance its potential applications in photodynamic therapy and as a photosensitizer in various chemical reactions.
Formula:C44H28Cl2N4Sn
InChI:InChI=1/C44H28N4.2ClH.Sn/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;;;/h1-28H;2*1H;/q-2;;;+4/p-2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-;;;
- Synonyms:
- Dichloro(5,10,15,20-tetraphenylporphyrinato)tin(IV)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Sn(IV) meso-Tetraphenylporphine dichloride (contains 1-3% chlorin) REF: FT-41359CAS: 26334-85-0 | >95% | To inquire | Mon 21 Apr 25 |

Sn(IV) meso-Tetraphenylporphine dichloride (contains 1-3% chlorin)
Ref: FT-41359
1g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |