CymitQuimica logo

CAS 263393-50-6

:

4-(Tetrahydro-2H-pyran-4-yl)piperidine

Description:
4-(Tetrahydro-2H-pyran-4-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a tetrahydro-2H-pyran moiety. This compound typically exhibits properties associated with both cyclic amines and ethers due to the presence of the piperidine and tetrahydropyran groups. It is generally a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The compound is likely to be soluble in organic solvents, reflecting the hydrophobic nature of its cyclic structures. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the piperidine ring is a common motif in many biologically active compounds. Additionally, the presence of the tetrahydro-2H-pyran unit may contribute to its stability and reactivity, making it a candidate for further chemical modifications. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H19NO
InChI:InChI=1S/C10H19NO/c1-5-11-6-2-9(1)10-3-7-12-8-4-10/h9-11H,1-8H2
InChI key:InChIKey=RALDDGVJYRQRSJ-UHFFFAOYSA-N
SMILES:C1(CCNCC1)C2CCOCC2
Synonyms:
  • 4-(Tetrahydro-2H-pyran-4-yl)piperidine
  • 4-(Tetrahydropyran-4-yl)piperidine
  • Piperidine, 4-(tetrahydro-2H-pyran-4-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.