CAS 263407-36-9

2-(3,4-Dihydroxyphenyl)-4H-naphtho[1,2-b]pyran-4-one

Description:

2-(3,4-Dihydroxyphenyl)-4H-naphtho[1,2-b]pyran-4-one, also known by its CAS number 263407-36-9, is a chemical compound characterized by its complex polycyclic structure, which includes a naphthoquinone moiety. This compound features a naphthopyran backbone, which is notable for its potential biological activities, including antioxidant and anti-inflammatory properties. The presence of hydroxyl groups on the phenyl ring enhances its reactivity and solubility in polar solvents, contributing to its potential applications in pharmaceuticals and natural product chemistry. The compound may exhibit fluorescence due to its conjugated system, making it of interest in various analytical and material science applications. Additionally, its structural features suggest potential interactions with biological targets, warranting further investigation into its pharmacological properties. Overall, 2-(3,4-Dihydroxyphenyl)-4H-naphtho[1,2-b]pyran-4-one represents a significant compound for research in medicinal chemistry and related fields.

Formula: C₁₉H₁₂O₄

InChI: InChI=1S/C19H12O4/c20-15-8-6-12(9-17(15)22)18-10-16(21)14-7-5-11-3-1-2-4-13(11)19(14)23-18/h1-10,20,22H

InChI key: InChIKey=AHSWGZBFVRIGHJ-UHFFFAOYSA-N

SMILES: O=C1C=2C(=C3C(=CC2)C=CC=C3)OC(=C1)C4=CC(O)=C(O)C=C4

Synonyms:

• 4H-Naphtho[1,2-b]pyran-4-one, 2-(3,4-dihydroxyphenyl)-
• 2-(3,4-Dihydroxyphenyl)-4H-naphtho[1,2-b]pyran-4-one

3',4'-Dihydroxy-α-napthoflavone

CAS: 263407-36-9

3',4'-Dihydroxy-α-napthoflavone is a synthetic flavonoid derivative, which is primarily recognized as a potent inhibitor of certain cytochrome P450 enzymes. Derived through chemical synthesis, its structure is akin to natural flavonoids but modified to enhance its biochemical interactions. This compound exhibits strong inhibitory effects on CYP1A1, CYP1A2, and CYP1B1 enzymes, which are key players in the metabolism of various xenobiotics and endogenous compounds.

Formula: C₁₉H₁₂O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 304.3 g/mol

Ref: 3D-XD182994