CAS 26346-85-0

2-bromo-1-(2,4-dimethylphenyl)ethanone

Description:

2-Bromo-1-(2,4-dimethylphenyl)ethanone, with the CAS number 26346-85-0, is an organic compound characterized by its ketone functional group and a bromine atom attached to the ethyl chain. This compound features a 2,4-dimethylphenyl group, which contributes to its aromatic properties and influences its reactivity and solubility. Typically, it appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the bromine atom enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its molecular structure suggests moderate polarity, which affects its solubility in organic solvents. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Safety precautions should be taken when handling this substance, as it may pose health risks due to its bromine content and potential reactivity. Overall, 2-bromo-1-(2,4-dimethylphenyl)ethanone is a valuable compound in synthetic organic chemistry and related fields.

Formula: C₁₀H₁₁BrO

InChI: InChI=1/C10H11BrO/c1-7-3-4-9(8(2)5-7)10(12)6-11/h3-5H,6H2,1-2H3

SMILES: Cc1ccc(c(C)c1)C(=O)CBr

Synonyms:

• Ethanone, 2-Bromo-1-(2,4-Dimethylphenyl)-
• 2-Bromo-1-(2,4-dimethylphenyl)ethanone

Ethanone, 2-bromo-1-(2,4-dimethylphenyl)-

CAS: 26346-85-0

Formula: C₁₀H₁₁BrO

Purity: 98%

Color and Shape: Solid

Molecular weight: 227.0977

Ref: IN-DA002SUJ

2,4-Dimethylphenacyl bromide

CAS: 26346-85-0

2,4-Dimethylphenacyl bromide

Formula: C₁₀H₁₁BrO

Purity: 98%

Color and Shape: yellow solid

Molecular weight: 227.10g/mol

Ref: 54-OR015117

2-Bromo-1-(2,4-dimethylphenyl)ethanone

CAS: 26346-85-0

Formula: C₁₀H₁₁BrO

Purity: 98%

Color and Shape: Solid

Molecular weight: 227.101

Ref: 10-F211289