CAS 2635-75-8
:Benzo[b]thiophene-4-acetic acid
Description:
Benzo[b]thiophene-4-acetic acid is an organic compound characterized by its unique structure, which includes a benzo[b]thiophene ring fused to an acetic acid moiety. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the presence of the thiophene ring, which contributes to its stability and reactivity. The carboxylic acid functional group (-COOH) in the acetic acid portion imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. Benzo[b]thiophene-4-acetic acid may also exhibit biological activity, making it of interest in pharmaceutical research. Its solubility can vary depending on the solvent, and it may show moderate polarity due to the presence of the carboxylic acid group. Overall, this compound is significant in organic synthesis and medicinal chemistry, with potential applications in developing new therapeutic agents.
Formula:C10H8O2S
InChI:InChI=1S/C10H8O2S/c11-10(12)6-7-2-1-3-9-8(7)4-5-13-9/h1-5H,6H2,(H,11,12)
InChI key:InChIKey=IFOMXIGWQFOYLA-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C2C(=CC=C1)SC=C2
Synonyms:- 1-Benzothiophen-4-Ylacetic Acid
- 2-(1-Benzothiophen-4-yl)acetic acid
- 2-(Benzo[b]thiophen-4-yl)acetic acid
- 4-Benzo[b]thienylacetic acid
- 4-Thianaphtheneacetic acid
- Benzo[b]thiophen-4-ylacetic acid
- Benzo[b]thiophene-4-acetic acid
- NSC 27409
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-(1-Benzothiophen-4-yl)acetic acid
CAS:2-(1-Benzothiophen-4-yl)acetic acid (2BA) is a phenoxy compound that has been isolated from a variety of plants. It is also found in coal tar and oil shale. 2BA has a high activity against bacteria, fungi and viruses, but its toxicity to humans is not well understood. 2BA has shown to have antibacterial properties which may be due to the inhibitory effects on bacterial DNA gyrase and topoisomerase IV. It also inhibits the production of nitric oxide by inhibiting the activation of inducible nitric oxide synthase (iNOS). This compound is also used as an intermediate for the synthesis of other chemicals such as salicylic acid or cinnamic acid. The chemical structure of 2BA consists of a benzene ring with two hydroxyl groups, a carboxylic acid group, and an ester linkage. END>Formula:C10H8O2SPurity:Min. 95%Molecular weight:192.24 g/mol

