CAS 26358-75-8
:(1α,3β)-Cholest-5-ene-1,3-diol
Description:
(1α,3β)-Cholest-5-ene-1,3-diol, with the CAS number 26358-75-8, is a sterol compound that plays a significant role in biological systems, particularly in the context of cell membrane structure and function. This compound features a steroid backbone, characterized by four fused carbon rings, and contains hydroxyl (-OH) groups at the 1 and 3 positions, which contribute to its polar characteristics. The presence of these hydroxyl groups enhances its solubility in polar solvents compared to other sterols. (1α,3β)-Cholest-5-ene-1,3-diol is involved in various biochemical processes, including serving as a precursor for the synthesis of bile acids and steroid hormones. Its structural configuration, particularly the stereochemistry at the 1α and 3β positions, is crucial for its biological activity and interaction with cellular membranes. This compound is of interest in research related to cholesterol metabolism, cardiovascular health, and the development of pharmaceuticals targeting lipid-related disorders.
Formula:C27H46O2
InChI:InChI=1S/C27H46O2/c1-17(2)7-6-8-18(3)22-11-12-23-21-10-9-19-15-20(28)16-25(29)27(19,5)24(21)13-14-26(22,23)4/h9,17-18,20-25,28-29H,6-8,10-16H2,1-5H3/t18-,20-,21+,22-,23+,24+,25+,26-,27+/m1/s1
InChI key:InChIKey=UXFVRWPSABSGRQ-AFWJMSMISA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@]([C@@H](CCCC(C)C)C)(CC4)[H])[H])(CC=C1C[C@@H](O)C[C@@H]2O)[H])[H]
Synonyms:- (1α,3β)-Cholest-5-ene-1,3-diol
- 1α-Hydroxycholesterol
- Cholest-5-ene-1α,3β-diol
- Cholest-5-ene-1,3-diol, (1α,3β)-
- Cholest-5-ene-1alpha,3beta-diol
- (1alpha,3beta)-cholest-5-ene-1,3-diol
- 1α-Hydroxycholesterin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

