CAS 26359-43-3
:3-(9,14-diethyl-4,8,13,18-tetramethyl-20-oxo-3,4-didehydro-24,25-dihydrophorbin-3-yl)propanoic acid
Description:
The chemical substance known as 3-(9,14-diethyl-4,8,13,18-tetramethyl-20-oxo-3,4-didehydro-24,25-dihydrophorbin-3-yl)propanoic acid, with the CAS number 26359-43-3, is a complex organic compound that belongs to the class of porphyrin derivatives. It features a porphyrin-like structure characterized by a macrocyclic arrangement of carbon and nitrogen atoms, which is typical for compounds involved in biological processes such as photosynthesis and respiration. The presence of multiple ethyl and methyl substituents contributes to its hydrophobic nature, while the carboxylic acid functional group imparts some polar characteristics, allowing for potential solubility in polar solvents. This compound may exhibit interesting optical properties due to its conjugated system, which can absorb light in the visible spectrum. Additionally, its structural complexity suggests potential applications in fields such as biochemistry, materials science, or as a dye. However, specific reactivity, stability, and biological activity would require further investigation through experimental studies.
Formula:C33H34N4O3
InChI:InChI=1/C33H34N4O3/c1-7-19-15(3)23-12-25-17(5)21(9-10-30(39)40)32(36-25)22-11-29(38)31-18(6)26(37-33(22)31)14-28-20(8-2)16(4)24(35-28)13-27(19)34-23/h12-14,34-35H,7-11H2,1-6H3,(H,39,40)/b23-12-,24-13-,25-12-,26-14-,27-13-,28-14-,32-22-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Phylloerythrin
CAS:Phylloerythrin is a photodynamic agent that originates from the breakdown of chlorophyll, primarily occurring in the digestive systems of herbivores. It is produced when chlorophyll is metabolized by gut microorganisms, leading to the formation of phylloerythrin, which is then absorbed into the bloodstream. Phylloerythrin is typically excreted by the liver into the bile; however, if liver function is compromised or overwhelmed, it can accumulate in the bloodstream.
Formula:C33H34N4O3Purity:Min. 95%Molecular weight:534.6 g/molRef: 3D-BBA35943
Discontinued product

