CAS 26360-21-4
:N-(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl](nitroso)amino}benzoyl)glutamic acid
Description:
N-(4-{[(2-amino-4-oxo-1,4-dihydropteridin-6-yl)methyl](nitroso)amino}benzoyl)glutamic acid, with CAS number 26360-21-4, is a complex organic compound characterized by its unique structure that incorporates both pteridine and amino acid functionalities. This substance features a glutamic acid moiety, which is an important amino acid involved in various metabolic processes. The presence of a nitroso group and a pteridinyl structure suggests potential biological activity, possibly related to its role in biochemical pathways or as a pharmacological agent. The compound may exhibit properties such as solubility in polar solvents, and its stability can be influenced by pH and temperature. Additionally, due to its intricate structure, it may participate in various chemical reactions, including those involving nucleophiles or electrophiles. Overall, this compound's characteristics make it of interest in medicinal chemistry and biochemistry, particularly in the context of drug design and development.
Formula:C19H18N8O7
InChI:InChI=1/C19H18N8O7/c20-19-24-15-14(17(31)25-19)22-10(7-21-15)8-27(26-34)11-3-1-9(2-4-11)16(30)23-12(18(32)33)5-6-13(28)29/h1-4,7,12H,5-6,8H2,(H,23,30)(H,28,29)(H,32,33)(H3,20,21,24,25,31)
SMILES:c1cc(ccc1C(=O)NC(CCC(=O)O)C(=O)O)N(Cc1cnc2c(c(nc(=N)[nH]2)O)n1)N=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 7 products.
N10-Nitroso Folic Acid Trifluoroacetate
CAS:Formula:C19H18N8O7·C2HF3O2Color and Shape:Pale Yellow SolidMolecular weight:470.40 114.02(4-(((2-Amino-4-oxo-3,4-dihydropteridin-6-yl)methyl)(nitroso)amino)benzoyl)-L-glutamic Acid
CAS:Formula:C19H18N8O7Color and Shape:Off-White To Light YellowMolecular weight:470.396(4-(((2-Amino-4-oxo-3,4-dihydropteridin-6-yl)methyl)(nitroso)amino)benzoyl-2,3,5,6-d4)glutamic Acid
CAS:Controlled ProductFormula:C19D4H14N8O7Color and Shape:NeatMolecular weight:474.42(4-(((2-Amino-4-oxo-3,4-dihydropteridin-6-yl)methyl)(nitroso)amino)benzoyl)-L-glutamic Acid (1 mg/mL in DMSO)
CAS:Formula:C19H18N8O7Color and Shape:Single SolutionMolecular weight:470.396


