CAS 2637-31-2

3-(3,4-dihydroquinolin-1(2H)-yl)propan-1-amine

Description:

3-(3,4-dihydroquinolin-1(2H)-yl)propan-1-amine, with the CAS number 2637-31-2, is an organic compound characterized by its structure, which includes a propan-1-amine moiety linked to a 3,4-dihydroquinoline ring. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the quinoline structure may impart additional biological activity, making it of interest in medicinal chemistry. It may also exhibit fluorescence properties due to the aromatic nature of the quinoline ring. The compound's potential applications could span various fields, including pharmaceuticals, where it may serve as a precursor or intermediate in the synthesis of more complex molecules. As with many organic compounds, its stability, reactivity, and interactions with other substances can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₂H₁₈N₂

InChI: InChI=1/C12H18N2/c13-8-4-10-14-9-3-6-11-5-1-2-7-12(11)14/h1-2,5,7H,3-4,6,8-10,13H2

SMILES: c1ccc2c(c1)CCCN2CCCN

Synonyms:

• 1(2H)-quinolinepropanamine, 3,4-dihydro-

1(2H)-Quinolinepropanamine, 3,4-dihydro-

CAS: 2637-31-2

Formula: C₁₂H₁₈N₂

Molecular weight: 190.2847

Ref: IN-DA002SWV

3-(3,4-Dihydro-2H-quinolin-1-yl)-propylamine

CAS: 2637-31-2

Formula: C₁₂H₁₈N₂

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 190.29

Ref: 10-F055239