CAS 263711-74-6

5,7-dihydroxy-2-[4-hydroxy(3,5-~2~H_2_)phenyl](~2~H_3_)-4H-chromen-4-one

Description:

5,7-Dihydroxy-2-[4-hydroxy(3,5-~2~H_2_)phenyl](~2~H_3_)-4H-chromen-4-one, identified by its CAS number 263711-74-6, is a flavonoid compound characterized by its chromone backbone, which features multiple hydroxyl groups that contribute to its potential biological activities. The presence of hydroxyl groups enhances its solubility in polar solvents and may increase its antioxidant properties. This compound is of interest in medicinal chemistry due to its potential therapeutic effects, including anti-inflammatory and anticancer activities. The structural modifications, such as the presence of the phenyl group and the specific arrangement of hydroxyl groups, can influence its reactivity and interaction with biological targets. Additionally, the isotopic labeling indicated by the notation (3,5-~2~H_2) suggests that certain hydrogen atoms in the molecule are replaced with deuterium, which can be useful in studies involving metabolic pathways or pharmacokinetics. Overall, this compound exemplifies the diverse functionalities of flavonoids and their relevance in various fields, including pharmacology and biochemistry.

Formula: C₁₅H₅D₅O₅

InChI: InChI=1/C15H10O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-7,16-18H/i3D,4D,5D,6D,7D

SMILES: c1c(c(c(cc1c1c(c(=O)c2c(c(c(c(c2o1)[2H])O)[2H])O)[2H])[2H])O)[2H]

Apigenin-d5

CAS: 263711-74-6

Formula: C₁₅H₅O₅D₅

Molecular weight: 275.27

Ref: 4Z-A-741

Apigenin-d5 (Major)

Controlled Product

CAS: 263711-74-6

Applications The labelled aglucon of apiin and of apigenin-7-glucoside.
References Chaumontet, C., et al.: Carcinogenesis, 15, 2325 (1994), Sato, F., et al.: Biochem. Biophys. Res. Commun., 204, 578 (1994), Kuo, M.L. et al.: Biochem. Biophys. Res. Commun., 212, 767 (1995)

Formula: C₁₅₂H₅H₅O₅

Color and Shape: Light Yellow Solid

Molecular weight: 275.27

Ref: TR-A726502

4H-1-Benzopyran-4-one-3,6,8-d3, 5,7-dihydroxy-2-(4-hydroxyphenyl-3,5-d2)-

CAS: 263711-74-6

Formula: C₁₅H₅D₅O₅

Color and Shape: Solid

Molecular weight: 275.2677

Ref: IN-DA002SX5