CymitQuimica logo

CAS 263762-14-7

:

3-(tert-butyl)-1-(4-fluorobenzyl)-1H-pyrazole-5-carbohydrazide

Description:
3-(tert-butyl)-1-(4-fluorobenzyl)-1H-pyrazole-5-carbohydrazide is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a tert-butyl group and a 4-fluorobenzyl moiety. This compound features a hydrazide functional group, which is known for its potential biological activity, including antimicrobial and anti-inflammatory properties. The presence of the fluorine atom in the benzyl group can enhance the lipophilicity and biological activity of the molecule. Typically, compounds like this are of interest in medicinal chemistry for their potential therapeutic applications. The molecular structure contributes to its physical properties, such as solubility and stability, which are crucial for its behavior in biological systems. Additionally, the compound may exhibit specific reactivity patterns due to the functional groups present, making it a candidate for further chemical modifications or as a lead compound in drug discovery. Overall, 3-(tert-butyl)-1-(4-fluorobenzyl)-1H-pyrazole-5-carbohydrazide represents a class of compounds that could be explored for various pharmacological applications.
Formula:C15H19FN4O
InChI:InChI=1/C15H19FN4O/c1-15(2,3)13-8-12(14(21)18-17)20(19-13)9-10-4-6-11(16)7-5-10/h4-8H,9,17H2,1-3H3,(H,18,21)
SMILES:CC(C)(C)c1cc(C(=NN)O)n(Cc2ccc(cc2)F)n1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.