
CAS 26378-54-1
:Ethanamine, 2-(2-chlorophenoxy)-, hydrochloride (1:1)
Description:
Ethanamine, 2-(2-chlorophenoxy)-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is an organic compound characterized by its amine functional group and the presence of a chlorophenoxy moiety. This compound typically appears as a white crystalline solid and is soluble in water due to the presence of the hydrochloride salt, which enhances its solubility compared to the free base form. The chlorophenoxy group contributes to its potential biological activity, making it of interest in pharmaceutical research. As an amine, it can participate in various chemical reactions, including alkylation and acylation, and may act as a nucleophile. The hydrochloride form is often used to improve stability and facilitate handling in laboratory and industrial settings. Safety data sheets should be consulted for specific handling and toxicity information, as compounds with amine and halogen substituents can exhibit varying degrees of biological activity and potential hazards. Overall, this compound's unique structure and properties make it a subject of interest in medicinal chemistry and related fields.
Formula:C8H10ClNO·ClH
InChI:InChI=1S/C8H10ClNO.ClH/c9-7-3-1-2-4-8(7)11-6-5-10;/h1-4H,5-6,10H2;1H
InChI key:InChIKey=WHGGIYJUHBWONH-UHFFFAOYSA-N
SMILES:O(CCN)C1=C(Cl)C=CC=C1.Cl
Synonyms:- Ethanamine, 2-(2-chlorophenoxy)-, hydrochloride (1:1)
- Ethylamine, 2-(o-chlorophenoxy)-, hydrochloride
- 2-(2-Chlorophenoxy)-1-ethanamine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
