CAS 26378-73-4
:2,4,6-Trichlororesorcinol
Description:
2,4,6-Trichlororesorcinol is an organic compound characterized by its chlorinated phenolic structure. It features three chlorine atoms substituted at the 2, 4, and 6 positions of the resorcinol backbone, which is a dihydroxybenzene. This compound typically appears as a white to pale yellow crystalline solid and is known for its solubility in organic solvents while being less soluble in water. It exhibits antimicrobial properties, making it useful in various applications, including as a preservative and in the formulation of certain pharmaceuticals and cosmetics. Additionally, 2,4,6-Trichlororesorcinol can act as a reagent in chemical synthesis and is studied for its potential in environmental applications, particularly in the treatment of wastewater. However, due to its chlorinated nature, it may pose environmental and health risks, necessitating careful handling and disposal. Its chemical stability and reactivity are influenced by the presence of the chlorine substituents, which can affect its interaction with other substances in various chemical processes.
Formula:C6H3Cl3O2
InChI:InChI=1S/C6H3Cl3O2/c7-2-1-3(8)6(11)4(9)5(2)10/h1,10-11H
InChI key:InChIKey=NHOATJNESSAPCQ-UHFFFAOYSA-N
SMILES:OC1=C(Cl)C(O)=C(Cl)C=C1Cl
Synonyms:- 1,3-Benzenediol, 2,4,6-trichloro-
- 2,4,6-Trichloro-1,3-Dihydroxy benzene
- 2,4,6-Trichloro-1,3-benzenediol
- 2,4,6-Trichlorobenzene-1,3-Diol
- NSC 36930
- Resorcinol, 2,4,6-trichloro-
- 2,4,6-Trichlororesorcinol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,3-Benzenediol, 2,4,6-trichloro-
CAS:Formula:C6H3Cl3O2Purity:95%Color and Shape:SolidMolecular weight:213.44582,4,6-Trichlorobenzene-1,3-diol
CAS:2,4,6-Trichlorobenzene-1,3-diolPurity:≥95%Molecular weight:213.45g/mol2,4,6-Trichlorobenzene-1,3-diol
CAS:2,4,6-Trichlorobenzene-1,3-diol is a chemical compound that belongs to the group of chlorinated hydrocarbons. It is an intermediate in the production of pentachlorophenol and other chlorinated compounds. The chlorination of 2,4,6-trichlorobenzene-1,3-diol can be achieved by introducing chlorine or hypochlorite into the molecule. A ring opening mechanism was observed for this compound in the presence of base. This reaction led to formation of a new ring with two chlorine atoms on one side and one chlorine atom on the other side. This reaction is known as a high yield process and can be used as a model compound for other chlorinated compounds.
Formula:C6H3Cl3O2Purity:Min. 95%Molecular weight:213.4 g/mol


