CAS 26383-05-1
:3'-deoxy-3'-methyladenosine
Description:
3'-Deoxy-3'-methyladenosine is a modified nucleoside derived from adenosine, characterized by the presence of a methyl group at the 3' position of the ribose sugar and the absence of an oxygen atom at the same position. This modification can influence the stability and biological activity of nucleic acids, making it of interest in various biochemical and pharmacological studies. The compound is typically involved in research related to RNA structure and function, as well as in the development of therapeutic agents. Its unique structural features may affect interactions with enzymes and other biomolecules, potentially altering metabolic pathways. The CAS number 26383-05-1 uniquely identifies this compound in chemical databases, facilitating its study and application in scientific research. Overall, 3'-deoxy-3'-methyladenosine serves as a valuable tool in understanding nucleic acid chemistry and the role of modifications in biological systems.
Formula:C11H15N5O3
InChI:InChI=1/C11H15N5O3/c1-5-6(2-17)19-11(8(5)18)16-4-15-7-9(12)13-3-14-10(7)16/h3-6,8,11,17-18H,2H2,1H3,(H2,12,13,14)/t5-,6-,8-,11-/m1/s1
SMILES:C[C@@H]1[C@@H](CO)O[C@H]([C@@H]1O)n1cnc2c(N)ncnc12
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3'-Deoxy-3'-a-C-methyladenosine
CAS:3'-Deoxy-3'-a-C-methyladenosine is a Nucleoside Derivative - 3'-Modified nucleoside.Formula:C11H15N5O3Color and Shape:SolidMolecular weight:265.273’-Deoxy-3’C-methyladenosine
CAS:<p>3’-Deoxy-3’C-methyladenosine is a reaction product of DNA and cancer cells. This product is generated by the glycosylase enzyme, which removes a methyl group from cytosine to produce 3’-deoxyadenosine. It has been shown that 3’-deoxy-3’C-methyladenosine accumulates in animal tissues after chronic treatment with an anticancer drug and can be detected using chromatographic methods. The presence of this compound in animals can be used as an indicator for carcinogenesis. 3’-Deoxy-3’C-methyladenosine has also been shown to inhibit the replication of mammalian cells.</p>Purity:Min. 95%

