CAS 26396-57-6
:1-(2,4-dichlorophenyl)-1H-pyrrole-2,5-dione
Description:
1-(2,4-Dichlorophenyl)-1H-pyrrole-2,5-dione, with the CAS number 26396-57-6, is a synthetic organic compound characterized by its unique structure, which includes a pyrrole ring substituted with a dichlorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to its ability to interact with various biological targets. It is often studied for its applications in pharmaceuticals and agrochemicals, as the presence of the dichlorophenyl moiety can enhance its lipophilicity and biological efficacy. The compound may also display notable stability under certain conditions, although its reactivity can vary depending on the functional groups present. In terms of solubility, it is generally soluble in organic solvents, which is common for many similar compounds. Safety and handling precautions are essential, as with many chlorinated compounds, due to potential toxicity and environmental concerns. Overall, 1-(2,4-dichlorophenyl)-1H-pyrrole-2,5-dione represents a class of compounds with significant interest in chemical research and application.
Formula:C10H5Cl2NO2
InChI:InChI=1/C10H5Cl2NO2/c11-6-1-2-8(7(12)5-6)13-9(14)3-4-10(13)15/h1-5H
SMILES:c1cc(c(cc1Cl)Cl)N1C(=O)C=CC1=O
Synonyms:- 1-(2,4-dichlorophenyl)-2,5-dihydro-1H-pyrrole-2,5-dione
- 1H-Pyrrole-2,5-dione, 1-(2,4-dichlorophenyl)-
- 1-(2,4-Dichlorophenyl)-1H-pyrrole-2,5-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Pyrrole-2,5-dione, 1-(2,4-dichlorophenyl)-
CAS:Formula:C10H5Cl2NO2Purity:97%Color and Shape:SolidMolecular weight:242.05821-(2,4-Dichlorophenyl)-1h-pyrrole-2,5-dione
CAS:1-(2,4-Dichlorophenyl)-1h-pyrrole-2,5-dionePurity:97%1-(2,4-Dichlorophenyl)-1H-pyrrole-2,5-dione
CAS:<p>Maleimide is a chemical compound with the molecular formula CH2=C(O)NHC(=O)CH2-CO2H. It is a reactive monomer that polymerizes in the presence of an initiator to form polymers. Maleimides are also used as cross-linking agents, and have been shown to be thermostable and stable at high temperatures. This particular maleimide is a colorless solid that has been shown to copolymerize with methyl methacrylate and other monomers to form thermally stable, hydrophobic polymers.</p>Formula:C10H5Cl2NO2Purity:Min. 95%Molecular weight:242.06 g/mol




