CAS 26404-66-0
:Peroxynitric acid
Description:
Peroxynitric acid, with the CAS number 26404-66-0, is a chemical compound that is a strong oxidizing agent and a reactive nitrogen species. It is formed from the reaction of nitric oxide (NO) and hydrogen peroxide (H2O2). This compound is characterized by its unstable nature, which can lead to decomposition under certain conditions, releasing nitrogen dioxide (NO2) and oxygen (O2). Peroxynitric acid is typically encountered in aqueous solutions and is known for its corrosive properties, making it hazardous to handle. It has been studied for its potential biological effects, particularly in the context of oxidative stress and inflammation, as it can modify proteins and lipids, impacting cellular functions. Due to its reactivity, peroxynitric acid is of interest in various fields, including environmental chemistry and biochemistry, where it may play a role in signaling pathways and the pathophysiology of certain diseases. Proper safety measures are essential when working with this compound due to its potential health risks.
Formula:HNO4
InChI:InChI=1S/HNO4/c2-1(3)5-4/h4H
InChI key:InChIKey=UUZZMWZGAZGXSF-UHFFFAOYSA-N
SMILES:N(OO)(=O)=O
Synonyms:- Pernitric acid
- Peroxynitric acid
- Peroxynitric acid (HO2NO2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
