CAS 2641-72-7
:1,1-dimethyl-2-phenylaziridinium
Description:
1,1-Dimethyl-2-phenylaziridinium is a quaternary ammonium compound characterized by its aziridine ring structure, which consists of a three-membered cyclic amine. The presence of two methyl groups at the nitrogen atom and a phenyl group at the second carbon of the aziridine ring contributes to its unique properties. This compound is typically a white to off-white solid and is soluble in polar organic solvents. It exhibits stability under standard conditions but may undergo hydrolysis or other reactions in the presence of strong nucleophiles or under acidic conditions. As a quaternary ammonium salt, it carries a positive charge, which influences its reactivity and interaction with biological systems. 1,1-Dimethyl-2-phenylaziridinium is of interest in organic synthesis and medicinal chemistry, particularly for its potential applications in drug development and as a reactive intermediate in various chemical reactions. Safety precautions should be taken when handling this compound, as with many aziridines, due to potential toxicity and reactivity.
Formula:C10H14N
InChI:InChI=1/C10H14N/c1-11(2)8-10(11)9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3/q+1
Synonyms:- aziridinium, 1,1-dimethyl-2-phenyl-
- 1,1-Dimethyl-2-phenylaziridinium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
