CAS 2642-82-2
:4-Chloro-β-(4-chlorophenyl)benzeneethanol
Description:
4-Chloro-β-(4-chlorophenyl)benzeneethanol, with the CAS number 2642-82-2, is an organic compound characterized by its aromatic structure and the presence of multiple chlorine substituents. This compound features a benzene ring with a hydroxyl (-OH) group and a β-chlorophenyl group, which contributes to its chemical reactivity and potential applications. The presence of chlorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its synthesis often involves electrophilic aromatic substitution reactions, and it may be used as an intermediate in the production of other chemical entities. Safety data should be consulted for handling, as chlorine-containing compounds can pose health risks. Overall, 4-Chloro-β-(4-chlorophenyl)benzeneethanol is notable for its structural complexity and potential utility in chemical synthesis.
Formula:C14H12Cl2O
InChI:InChI=1S/C14H12Cl2O/c15-12-5-1-10(2-6-12)14(9-17)11-3-7-13(16)8-4-11/h1-8,14,17H,9H2
InChI key:InChIKey=ZVIDYKRNLNAXFT-UHFFFAOYSA-N
SMILES:C(CO)(C1=CC=C(Cl)C=C1)C2=CC=C(Cl)C=C2
Synonyms:- 2,2-Bis(4-chlorophenyl)-1-hydroxyethane
- 2,2-Bis(P-Chlorophenyl)Ethanol
- 4,4-Ddoh
- 4-Chloro-β-(4-chlorophenyl)benzeneethanol
- Benzeneethanol, 4-chloro-β-(4-chlorophenyl)-
- Ethanol, 2,2-bis(p-chlorophenyl)-
- NSC 8942
- p,p′-DDOH
- DDOH
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
