CymitQuimica logo

CAS 264208-72-2

:

4-chloro-6-methoxy-7-[(1-methyl-4-piperidinyl)methoxy]-Quinazoline

Description:
4-Chloro-6-methoxy-7-[(1-methyl-4-piperidinyl)methoxy]-quinazoline is a synthetic organic compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This compound features a chlorine atom at the 4-position and a methoxy group at the 6-position, contributing to its chemical reactivity and potential biological activity. The presence of a 1-methyl-4-piperidinyl group at the 7-position enhances its pharmacological properties, possibly influencing its interaction with biological targets. The methoxy substituents can affect solubility and lipophilicity, which are important for drug design. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and pharmaceutical research. Its specific properties, such as melting point, solubility, and spectral characteristics, would typically be determined through experimental methods and can vary based on the conditions of synthesis and purification. As with many quinazoline derivatives, it may have potential applications in treating various diseases, including cancer and neurological disorders.
Formula:C16H20ClN3O2
InChI:InChI=1S/C16H20ClN3O2/c1-20-5-3-11(4-6-20)9-22-15-8-13-12(7-14(15)21-2)16(17)19-10-18-13/h7-8,10-11H,3-6,9H2,1-2H3
InChI key:XAVZTXQALXOZJS-UHFFFAOYSA-N
SMILES:CN1CCC(CC1)COC2=C(C=C3C(=C2)N=CN=C3Cl)OC
Synonyms:
  • 4-Chloro-6-methoxy-7-(4-methyl-piperidin-1-ylmethoxy)-quinazoline
  • 4-Chloro-7-[N-Methylpiperidin-4-Ylmethoxy]-6-Methoxyquinazoline
Found 1 products.