CAS 264273-08-7
:(4S)-4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-1,3,4,5-tetrahydro-3-oxo-2H-2-benzazepine-2-acetic acid
Description:
The chemical substance known as (4S)-4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-1,3,4,5-tetrahydro-3-oxo-2H-2-benzazepine-2-acetic acid, with the CAS number 264273-08-7, is a complex organic compound characterized by its unique structural features. It contains a benzazepine core, which is a bicyclic structure that incorporates both a benzene and a seven-membered nitrogen-containing ring. The presence of a fluorenylmethoxycarbonyl (Fmoc) group indicates that this compound is likely used in peptide synthesis as a protective group for amino acids. The tetrahydro structure suggests that it has a saturated ring system, contributing to its stability and reactivity. Additionally, the presence of a carboxylic acid functional group implies potential for hydrogen bonding and interactions with other molecules, making it relevant in biochemical applications. Overall, this compound's intricate structure and functional groups position it as a significant entity in medicinal chemistry and drug development, particularly in the context of peptide and protein synthesis.
Formula:C27H24N2O5
InChI:InChI=1S/C27H24N2O5/c30-25(31)15-29-14-18-8-2-1-7-17(18)13-24(26(29)32)28-27(33)34-16-23-21-11-5-3-9-19(21)20-10-4-6-12-22(20)23/h1-12,23-24H,13-16H2,(H,28,33)(H,30,31)/t24-/m0/s1
InChI key:InChIKey=RPAHAHMAXJASPS-DEOSSOPVSA-N
SMILES:C(OC(N[C@H]1CC=2C(CN(CC(O)=O)C1=O)=CC=CC2)=O)C3C=4C(C=5C3=CC=CC5)=CC=CC4
Synonyms:- (4S)-4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-1,3,4,5-tetrahydro-3-oxo-2H-2-benzazepine-2-acetic acid
- (S)-Fmoc-4-Amino-2-Carboxymethyl-1,3,4,5-Tetrahydro-2H-[2]-Benzazepin-3-One
- 2H-2-Benzazepine-2-acetic acid, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-1,3,4,5-tetrahydro-3-oxo-, (4S)-
- Fmoc-(S)-4-Amino-2-Carboxymethyl-1,3,4,5-Tetrahydro-2H-[2]-Benzazepin-3-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(4S)-4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-1,3,4,5-tetrahydro-3-oxo-2H-2-benzazepine-2-acetic acid
CAS:Formula:C27H24N2O5Color and Shape:SolidMolecular weight:456.4899Fmoc-(S)-4-amino-2-carboxymethyl-1,3,4,5-tetrahydro-2H-[2]benzazepin-3-one
CAS:Fmoc-(S)-4-amino-2-carboxymethyl-1,3,4,5-tetrahydro-2H-[2]benzazepin-3-one is a specialized chemical compound, which is an Fmoc-protected amino acid derivative. This compound is synthesized through a series of organic synthesis steps that incorporate chiral precursors to ensure enantiomeric purity. As a building block for peptide synthesis, it acts by introducing a protected amino function into the peptide chain, providing stability and selectivity during the synthesis process.The primary applications of Fmoc-(S)-4-amino-2-carboxymethyl-1,3,4,5-tetrahydro-2H-[2]benzazepin-3-one are in the fields of medicinal chemistry and drug discovery, where it plays a crucial role in the development of novel peptide-based therapeutics. This compound is particularly valuable due to its ability to enhance the bioavailability and metabolic stability of peptides, allowing for the exploration of new therapeutic pathways and functions. Its use is integral in the design of peptides with specific biological activities, facilitating research into new pharmacological agents and treatments.Formula:C27H24N2O5Purity:Min. 95%Molecular weight:456.49 g/mol

