CAS 264273-09-8

3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]hexahydro-2-oxo-1H-azepine-1-acetic acid

Description:

3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]hexahydro-2-oxo-1H-azepine-1-acetic acid, with CAS number 264273-09-8, is a synthetic compound that features a complex structure characterized by a hexahydro-azepine ring, a carbonyl group, and an acetic acid moiety. The presence of the fluorenylmethoxycarbonyl (Fmoc) group indicates its use in peptide synthesis, particularly as a protective group for amino acids. This compound is likely to exhibit properties typical of amino acids, such as solubility in polar solvents and potential reactivity at the carboxylic acid and amine functional groups. Its structure suggests it may participate in various chemical reactions, including peptide bond formation and other transformations relevant in organic synthesis. Additionally, the azepine ring may contribute to its biological activity, making it of interest in medicinal chemistry. Overall, this compound's unique structural features and functional groups position it as a valuable intermediate in chemical research and development.

Formula: C₂₃H₂₄N₂O₅

InChI: InChI=1S/C23H24N2O5/c26-21(27)13-25-12-6-5-11-20(22(25)28)24-23(29)30-14-19-17-9-3-1-7-15(17)16-8-2-4-10-18(16)19/h1-4,7-10,19-20H,5-6,11-14H2,(H,24,29)(H,26,27)

InChI key: InChIKey=ZYSRRJZAOFHCSC-UHFFFAOYSA-N

SMILES: C(OC(NC1C(=O)N(CC(O)=O)CCCC1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• 3-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]hexahydro-2-oxo-1H-azepine-1-acetic acid
• 1H-Azepine-1-acetic acid, 3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]hexahydro-2-oxo-
• 2-[3-([[(9H-Fluoren-9-yl)methoxy]carbonyl]amino)-2-oxoazepan-1-yl]acetic acid

2-[3-({[(9H-Fluoren-9-yl)methoxy]carbonyl}amino)-2-oxoazepan-1-yl]acetic acid

CAS: 264273-09-8

Versatile small molecule scaffold

Formula: C₂₃H₂₄N₂O₅

Purity: Min. 95%

Molecular weight: 408.4 g/mol

Ref: 3D-PKA27309