CAS 2645-08-1: N-Benzoyl-L-arginine ethyl ester hydrochloride
Description:N-Benzoyl-L-arginine ethyl ester hydrochloride is a chemical compound that belongs to the class of amino acid derivatives. It is characterized by the presence of an arginine residue, which is an essential amino acid known for its role in protein synthesis and various metabolic processes. The compound features a benzoyl group attached to the amino acid, enhancing its lipophilicity and potentially influencing its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including biochemical research and pharmaceutical formulations. The compound may exhibit properties such as being a substrate for proteolytic enzymes or serving as an inhibitor in enzymatic reactions. Its structural characteristics allow it to interact with biological systems, making it of interest in studies related to drug design and development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C15H22N4O3·ClH
InChI:InChI=1S/C15H22N4O3.ClH/c1-2-22-14(21)12(9-6-10-18-15(16)17)19-13(20)11-7-4-3-5-8-11;/h3-5,7-8,12H,2,6,9-10H2,1H3,(H,19,20)(H4,16,17,18);1H/t12-;/m0./s1
InChI key:InChIKey=HIXDELXKSSLIKB-YDALLXLXSA-N
SMILES:Cl.O=C(OCC)C(NC(=O)C=1C=CC=CC1)CCCNC(=N)N
- Synonyms:
- <span class="text-smallcaps">L</span>-Arginine, N<sup>2</sup>-benzoyl-, ethyl ester, hydrochloride (1:1)
- <span class="text-smallcaps">L</span>-Arginine, N<sup>2</sup>-benzoyl-, ethyl ester, monohydrochloride
- Arginine, N<sup>2</sup>-benzoyl-, ethyl ester, monohydrochloride, <span class="text-smallcaps">L</span>-
- Baee
- Benzoyl-Arg-OEt.HCl
- Bz-Arg-OEt . HCl
- Bz-Arg-OEt・HCl
- Ethyl N-benzoyl-α-arginine hydrochloride
- N--Benzoyl-L-arginine ethyl ester hydrochloride
- N-Benzoyl-<span class="text-smallcaps">L</span>-arginine ethyl ester hydrochloride
- See more synonyms
- N-alpha-Benzoyl-L-argininethylester Hydrochloride = BAEE
- N-α-Benzoyl-<span class="text-smallcaps">L</span>-arginine ethyl ester hydrochloride
- NSC 86159
- ethyl N~2~-benzoylargininate
- {[(1S)-4-[(diaminomethylidene)ammonio]-1-(ethoxycarbonyl)butyl]carbamoyl}benzene
- α-N-Benzoyl-<span class="text-smallcaps">L</span>-arginine ethyl ester hydrochloride
- L-Arginine, N2-benzoyl-, ethyl ester, monohydrochloride
- Arginine, N2-benzoyl-, ethyl ester, monohydrochloride, L-
- α-N-Benzoyl-L-arginine ethyl ester hydrochloride
- L-Arginine, N2-benzoyl-, ethyl ester, hydrochloride (1:1)
