CAS 26453-01-0

2,3-Dihydro-1H-indene-2-carbonitrile

Description:

2,3-Dihydro-1H-indene-2-carbonitrile, with the CAS number 26453-01-0, is an organic compound characterized by its bicyclic structure, which consists of a fused indene ring system and a carbonitrile functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its unique structural features that can facilitate various chemical reactions. The presence of the carbonitrile group contributes to its reactivity, allowing it to participate in nucleophilic addition and other transformations. Additionally, 2,3-Dihydro-1H-indene-2-carbonitrile may exhibit interesting physical properties, such as moderate solubility in organic solvents and varying boiling and melting points, which are influenced by its molecular interactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₉N

InChI: InChI=1S/C10H9N/c11-7-8-5-9-3-1-2-4-10(9)6-8/h1-4,8H,5-6H2

InChI key: InChIKey=DNZFSDYPKGZHAA-UHFFFAOYSA-N

SMILES: C(#N)C1CC=2C(C1)=CC=CC2

Synonyms:

• 2-Indanecarbonitrile
• 2,3-Dihydro-1H-indene-2-carbonitrile
• 2-Cyanoindan
• 1H-Indene-2-carbonitrile, 2,3-dihydro-
• 2-Indancarbonitrile

2,3-Dihydro-1H-indene-2-carbonitrile

CAS: 26453-01-0

Formula: C₁₀H₉N

Purity: 95%

Molecular weight: 143.1852

Ref: IN-DA002TA3

Indan-2-carbonitrile

CAS: 26453-01-0

Formula: C₁₀H₉N

Purity: 98.0%

Molecular weight: 143.189

Ref: 10-F330274

2,3-Dihydro-1H-indene-2-carbonitrile

CAS: 26453-01-0

2,3-Dihydro-1H-indene-2-carbonitrile is a chemical compound that is used to synthesize enantiopure naphthalenes. It reacts with benzylpiperidine in the presence of sodium methoxide and potassium carbonate in a kinetic, stereoselective manner to form a 2,3-dihydro-1H-indene derivative. The compound can also be decyanated with dichromate to yield an olefinic product. The 2,3-dihydro-1H-indene derivative can be converted into its corresponding indane by catalyzed hydrogenation or stereochemical means through the use of dichroism spectroscopy.

Formula: C₁₀H₉N

Purity: Min. 95%

Molecular weight: 143.18 g/mol

Ref: 3D-BBA45301