CAS 2646-61-9
:N-cbz-gly-pro-leu-gly-pro
Description:
N-Cbz-gly-pro-leu-gly-pro, also known by its CAS number 2646-61-9, is a synthetic peptide that consists of a sequence of amino acids, specifically glycine (Gly), proline (Pro), and leucine (Leu), with a carbobenzyloxy (Cbz) protecting group on the amino terminal. This compound is characterized by its relatively low solubility in water, which is typical for peptides with hydrophobic residues like leucine. The presence of proline in the sequence contributes to its unique conformational properties, often leading to the formation of specific secondary structures. N-Cbz-gly-pro-leu-gly-pro is primarily used in peptide synthesis and research, particularly in studies related to peptide bonding and the development of peptide-based pharmaceuticals. Its stability and reactivity can be influenced by the protecting groups and the specific amino acid sequence, making it a valuable compound in the field of medicinal chemistry and biochemistry.
Formula:C28H39N5O8
InChI:InChI=1/C28H39N5O8/c1-18(2)14-20(25(36)29-15-23(34)33-13-7-11-22(33)27(38)39)31-26(37)21-10-6-12-32(21)24(35)16-30-28(40)41-17-19-8-4-3-5-9-19/h3-5,8-9,18,20-22H,6-7,10-17H2,1-2H3,(H,29,36)(H,30,40)(H,31,37)(H,38,39)
SMILES:CC(C)CC(C(=NCC(=O)N1CCCC1C(=O)O)O)N=C(C1CCCN1C(=O)CN=C(O)OCC1=CC=CC=C1)O
Synonyms:- Z-Gly-Pro-Leu-Gly-Pro-OH
- N-[(benzyloxy)carbonyl]glycyl-L-prolyl-L-leucylglycyl-L-proline
- N-[(benzyloxy)carbonyl]glycylprolylleucylglycylproline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Z-Gly-Pro-Leu-Gly-Pro
CAS:<p>Z-Gly-Pro-Leu-Gly-Pro is a synthetic substrate that has been shown to be hydrolyzed by human liver collagenase. It is used as a substrate in enzymatic assays, such as the determination of collagenase activity. The peptide is synthesized from glycine, proline, and glycolic acid. Z-Gly-Pro-Leu-Gly-Pro has an optimal ph of 7.0 and shows signals at 2.8 ppm (HNCH) and 3.5 ppm (HNCO). This peptide also binds to bacterial enzymes such as trypsin and chymotrypsin.</p>Formula:C28H39N5O8Purity:Min. 95%Molecular weight:573.64 g/molZ-Gly-Pro-Leu-Gly-Pro-OH
CAS:<p>Z-Gly-Pro-Leu-Gly-Pro-OH is a synthetic peptide that is hydrophobic and has a sequence of amino acids. It can be used as a substrate for proteolytic enzymes. Z-Gly-Pro-Leu-Gly-Pro-OH has been shown to have collagenase activity in human liver and porcine tissues, but not in the presence of chloromethyl ketone. The neutral pH is important for this reaction because it increases the solubility of the substrate. This product is also soluble in water, making it easier to use in experiments.</p>Formula:C28H39N5O8Purity:Min. 95%Molecular weight:573.64 g/mol
