CAS 264622-53-9
:N-(4-Acetylphenyl)-2-[4-(2,3,6,9-tetrahydro-2,6-dioxo-1,3-dipropyl-1H-purin-8-yl)phenoxy]acetamide
Description:
N-(4-Acetylphenyl)-2-[4-(2,3,6,9-tetrahydro-2,6-dioxo-1,3-dipropyl-1H-purin-8-yl)phenoxy]acetamide, with CAS number 264622-53-9, is a synthetic organic compound characterized by its complex structure, which includes an acetylphenyl group and a purine derivative. This compound features multiple functional groups, including an amide and ether linkage, contributing to its potential biological activity. The presence of the tetrahydro-purine moiety suggests that it may interact with biological systems, possibly influencing nucleic acid metabolism or enzyme activity. Its solubility and stability can vary depending on the solvent and environmental conditions, which are critical for its application in research or pharmaceutical contexts. The compound's molecular weight, melting point, and spectral properties (such as NMR and IR) would provide further insights into its characteristics and potential uses. Overall, this compound represents a class of molecules that may have implications in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways.
Formula:C27H29N5O5
InChI:InChI=1S/C27H29N5O5/c1-4-14-31-25-23(26(35)32(15-5-2)27(31)36)29-24(30-25)19-8-12-21(13-9-19)37-16-22(34)28-20-10-6-18(7-11-20)17(3)33/h6-13H,4-5,14-16H2,1-3H3,(H,28,34)(H,29,30)
InChI key:InChIKey=ZKUCFFYOQOJLGT-UHFFFAOYSA-N
SMILES:C(CC)N1C2=C(NC(=N2)C3=CC=C(OCC(NC4=CC=C(C(C)=O)C=C4)=O)C=C3)C(=O)N(CCC)C1=O
Synonyms:- Acetamide, N-(4-acetylphenyl)-2-[4-(2,3,6,7-tetrahydro-2,6-dioxo-1,3-dipropyl-1H-purin-8-yl)phenoxy]-
- MRS 1706
- Acetamide, N-(4-acetylphenyl)-2-[4-(2,3,6,9-tetrahydro-2,6-dioxo-1,3-dipropyl-1H-purin-8-yl)phenoxy]-
- N-(4-Acetylphenyl)-2-[4-(2,3,6,9-tetrahydro-2,6-dioxo-1,3-dipropyl-1H-purin-8-yl)phenoxy]acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
MRS-1706
CAS:MRS-1706: Ki of 1.39nM for A2B; selective inverse agonist; also affects A2A, A1, A3.Formula:C27H29N5O5Purity:99.00%Color and Shape:SolidMolecular weight:503.55Ref: TM-T16136
1mg34.00€5mg74.00€10mg113.00€25mg222.00€50mg356.00€100mg572.00€200mg803.00€1mL*10mM (DMSO)84.00€N-(4-acetylphenyl)-2-[4-(2,6-dioxo-1,3-dipropyl-2,3,6,7-tetrahydro-1H-purin-8-yl)phenoxy]acetamide
CAS:Purity:98%Molecular weight:503.5589905MRS-1706
CAS:Controlled ProductMRS-1706 is a compound that inhibits the effect of ATP on P2Y receptors. MRS-1706 has been shown to be effective in reducing inflammation and suppressing the proliferation of cells, which are associated with primary sclerosing cholangitis (PSC). The drug also has an inhibitory effect on adenosine production by affecting the mitochondrial membrane potential and Ca2+ overload. MRS-1706 can reduce camp levels, inhibit receptor activity and increase gamma-aminobutyric acid levels, leading to decreased cellular proliferation. MRS-1706 also binds to A3 adenosine receptors, which leads to a reduction in cell proliferation.
Formula:C27H29N5O5Purity:Min. 95%Molecular weight:503.55 g/molRef: 3D-PKA62253
Discontinued product





