CAS 264624-38-6: 26-Deoxyactein
Description:26-Deoxyactein is a chemical compound classified as a triterpenoid saponin, primarily derived from the plant species Actaea racemosa, commonly known as black cohosh. This compound is notable for its potential pharmacological properties, particularly in the context of women's health, where it has been studied for its effects on menopausal symptoms and hormonal balance. Structurally, 26-Deoxyactein features a complex arrangement of carbon, hydrogen, and oxygen atoms, contributing to its biological activity. It is characterized by its ability to interact with various biological pathways, including estrogen receptor modulation, which may explain its therapeutic effects. Additionally, 26-Deoxyactein exhibits anti-inflammatory and antioxidant properties, making it of interest in the field of natural product research. As with many saponins, it may also possess surfactant properties, influencing its solubility and bioavailability. However, further research is necessary to fully elucidate its mechanisms of action and potential therapeutic applications.
Formula:C37H56O10
InChI:InChI=1S/C37H56O10/c1-18-12-37(30-33(6,47-30)17-43-37)46-21-13-32(5)23-9-8-22-31(3,4)24(45-29-28(41)27(40)20(39)15-42-29)10-11-35(22)16-36(23,35)14-25(44-19(2)38)34(32,7)26(18)21/h18,20-30,39-41H,8-17H2,1-7H3/t18-,20-,21+,22+,23+,24+,25-,26+,27+,28-,29+,30-,32+,33-,34-,35-,36+,37+/m1/s1
InChI key:InChIKey=GCMGJWLOGKSUGX-RBKCHLQLSA-N
SMILES:O=C(OC1CC23CC43CCC(OC5OCC(O)C(O)C5O)C(C)(C)C4CCC2C6(C)CC7OC8(OCC9(OC89)C)CC(C)C7C16C)C
- Synonyms:
- (3β,12β,16β,23S,24R,25R)-12-(Acetyloxy)-16,23:23,26:24,25-triepoxy-9,19-cyclolanostan-3-yl β-<span class="text-smallcaps">D</span>-xylopyranoside
- 26-Deoxyactein
- 27-Deoxyactein
- β-<span class="text-smallcaps">D</span>-Xylopyranoside, (3β,12β,16β,23S,24R,25R)-12-(acetyloxy)-16,23:23,26:24,25-triepoxy-9,19-cyclolanostan-3-yl
- β-D-Xylopyranoside, (3β,12β,16β,23S,24R,25R)-12-(acetyloxy)-16,23:23,26:24,25-triepoxy-9,19-cyclolanostan-3-yl
- (3β,12β,16β,23S,24R,25R)-12-(Acetyloxy)-16,23:23,26:24,25-triepoxy-9,19-cyclolanostan-3-yl β-D-xylopyranoside
